CAS 3016437-05-8 appears in our catalog under these names: Androgen receptor–IN–6, Androgen receptor-IN-6, 98.26%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 5 mg, 25 mg.
3-(1-methylindazol-5-yl)-4-methylsulfanylbenzamide (CAS 3016437-05-8) is a chemical compound with the molecular formula C16H15N3OS and a molecular weight of 297.4 g/mol. IUPAC name: 3-(1-methylindazol-5-yl)-4-methylsulfanylbenzamide. InChIKey: LAJCSSWPGDDWCX-UHFFFAOYSA-N.
| Molecular formula | C16H15N3OS |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 3-(1-methylindazol-5-yl)-4-methylsulfanylbenzamide |
| InChIKey | LAJCSSWPGDDWCX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C3=C(C=CC(=C3)C(=O)N)SC)C=N1 |
Computed by PubChem (NCBI)