CAS 301681-50-5 is the registry number for N-(4-(N-(3,4-Dimethylisoxazol-5-yl)sulfamoyl)phenyl)-4-methoxybenzamide. Offered by: Chemat. Available pack sizes: 250mg, 1g, 100mg.
N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-methoxybenzamide (CAS 301681-50-5) is a chemical compound with the molecular formula C19H19N3O5S and a molecular weight of 401.4 g/mol. IUPAC name: N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-methoxybenzamide. InChIKey: KFEMQBROBHMUBC-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O5S |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-4-methoxybenzamide |
| InChIKey | KFEMQBROBHMUBC-UHFFFAOYSA-N |
| SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)