Products 301683-08-9

CAS 301683-08-9 is the registry number for 2-[(6-Chloro-4-methyl-2-oxo-2h-chromen-7-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxypropanoic acid (CAS 301683-08-9) is a chemical compound with the molecular formula C13H11ClO5 and a molecular weight of 282.67 g/mol. IUPAC name: 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxypropanoic acid. InChIKey: UBJGTVXAFAIJDS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClO5
Molecular weight282.67 g/mol
IUPAC name2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxypropanoic acid
InChIKeyUBJGTVXAFAIJDS-UHFFFAOYSA-N
SMILESCC1=CC(=O)OC2=CC(=C(C=C12)Cl)OC(C)C(=O)O

Computed by PubChem (NCBI)