CAS 301693-28-7 appears in our catalog under these names: Polmacoxib Impurity 6, 4-(3-(2-Fluorophenyl)-5,5-dimethyl-4-oxo-4,5-dihydrofuran-2-yl)benzenesulfonamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
4-[3-(2-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide (CAS 301693-28-7) is a chemical compound with the molecular formula C18H16FNO4S and a molecular weight of 361.4 g/mol. IUPAC name: 4-[3-(2-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide. InChIKey: BTUAYXMLISLDMZ-UHFFFAOYSA-N.
| Molecular formula | C18H16FNO4S |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 4-[3-(2-fluorophenyl)-5,5-dimethyl-4-oxofuran-2-yl]benzenesulfonamide |
| InChIKey | BTUAYXMLISLDMZ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C(=C(O1)C2=CC=C(C=C2)S(=O)(=O)N)C3=CC=CC=C3F)C |
Computed by PubChem (NCBI)