CAS 1326915-46-1 is the registry number for 3-[(4-Ethoxyphenyl)sulfonyl]-7-fluoro-1-methylquinolin-4(1h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3-(4-ethoxyphenyl)sulfonyl-7-fluoro-1-methylquinolin-4-one (CAS 1326915-46-1) is a chemical compound with the molecular formula C18H16FNO4S and a molecular weight of 361.4 g/mol. IUPAC name: 3-(4-ethoxyphenyl)sulfonyl-7-fluoro-1-methylquinolin-4-one. InChIKey: DEUSSODQEXXSHE-UHFFFAOYSA-N.
| Molecular formula | C18H16FNO4S |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 3-(4-ethoxyphenyl)sulfonyl-7-fluoro-1-methylquinolin-4-one |
| InChIKey | DEUSSODQEXXSHE-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)C2=CN(C3=C(C2=O)C=CC(=C3)F)C |
Computed by PubChem (NCBI)