CAS 3017-60-5 appears in our catalog under these names: Cobalt(ii) thiocyanate, 95%, Cobalt(II) Thiocyanate, Cobalt(II)thiocyanate, Cobalt(II) thiocyanate, 98+% , Cobalt(II) Thiocyanate, >98.0%(T). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 50g, 250g, 125G.
Cobalt(2+) dithiocyanate (CAS 3017-60-5) is a chemical compound with the molecular formula C2CoN2S2 and a molecular weight of 175.10 g/mol. IUPAC name: cobalt(2+) dithiocyanate. InChIKey: INDBQWVYFLTCFF-UHFFFAOYSA-L.
| Molecular formula | C2CoN2S2 |
|---|---|
| Molecular weight | 175.10 g/mol |
| IUPAC name | cobalt(2+) dithiocyanate |
| InChIKey | INDBQWVYFLTCFF-UHFFFAOYSA-L |
| SMILES | C(#N)[S-].C(#N)[S-].[Co+2] |
Computed by PubChem (NCBI)