CAS 3017217-08-9 is the registry number for Antiproliferative agent-44. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-4-imino-5-thiophen-2-yl-5,7,8,9-tetrahydrochromeno[2,3-d]pyrimidin-6-one (CAS 3017217-08-9) is a chemical compound with the molecular formula C15H14N4O2S and a molecular weight of 314.4 g/mol. IUPAC name: 3-amino-4-imino-5-thiophen-2-yl-5,7,8,9-tetrahydrochromeno[2,3-d]pyrimidin-6-one. InChIKey: FPYVPWUVSVOWLO-UHFFFAOYSA-N.
| Molecular formula | C15H14N4O2S |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 3-amino-4-imino-5-thiophen-2-yl-5,7,8,9-tetrahydrochromeno[2,3-d]pyrimidin-6-one |
| InChIKey | FPYVPWUVSVOWLO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(C3=C(O2)N=CN(C3=N)N)C4=CC=CS4)C(=O)C1 |
Computed by PubChem (NCBI)