CAS 3017240-62-6 is the registry number for TFSeB. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[3-(trifluoromethyl)phenyl]selanylmethyl]-2,3-dihydro-1-benzofuran (CAS 3017240-62-6) is a chemical compound with the molecular formula C16H13F3OSe and a molecular weight of 357.2 g/mol. IUPAC name: 2-[[3-(trifluoromethyl)phenyl]selanylmethyl]-2,3-dihydro-1-benzofuran. InChIKey: DZJSEHYIHJKSHD-UHFFFAOYSA-N.
| Molecular formula | C16H13F3OSe |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | 2-[[3-(trifluoromethyl)phenyl]selanylmethyl]-2,3-dihydro-1-benzofuran |
| InChIKey | DZJSEHYIHJKSHD-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C21)C[Se]C3=CC=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)