CAS 3017266-45-1 appears in our catalog under these names: 3-[4-(Bromomethyl)phenyl]-6-methyl-1,2,4,5-tetrazine, >98.0%(HPLC)(qNMR), 3-[4-(Bromomethyl)phenyl]-6-methyl-1,2,4,5-tetrazine, 98.0%, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 200mg, 1g.
3-[4-(bromomethyl)phenyl]-6-methyl-1,2,4,5-tetrazine (CAS 3017266-45-1) is a chemical compound with the molecular formula C10H9BrN4 and a molecular weight of 265.11 g/mol. IUPAC name: 3-[4-(bromomethyl)phenyl]-6-methyl-1,2,4,5-tetrazine. InChIKey: HLQBBHCFIPGODG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN4 |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | 3-[4-(bromomethyl)phenyl]-6-methyl-1,2,4,5-tetrazine |
| InChIKey | HLQBBHCFIPGODG-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)