CAS 3020-28-8 appears in our catalog under these names: (Iodomethyl)triphenylphosphonium iodide, (Iodomethyl)triphenylphosphonium Iodide, >95.0%(HPLC)(T), (Iodomethyl)triphenylphosphonium iodide 97%, (Iodomethyl)triphenylphosphonium iodide, 95%, 95%, Iodomethyl-triphenyl-phosphonium iodide, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 1000g, 10g, 500g, 1kg.
Iodomethyl(triphenyl)phosphanium iodide (CAS 3020-28-8) is a chemical compound with the molecular formula C19H17I2P and a molecular weight of 530.1 g/mol. IUPAC name: iodomethyl(triphenyl)phosphanium iodide. InChIKey: NAVMMSRRNOXQMJ-UHFFFAOYSA-M.
| Molecular formula | C19H17I2P |
|---|---|
| Molecular weight | 530.1 g/mol |
| IUPAC name | iodomethyl(triphenyl)phosphanium iodide |
| InChIKey | NAVMMSRRNOXQMJ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CI)(C2=CC=CC=C2)C3=CC=CC=C3.[I-] |
Computed by PubChem (NCBI)