CAS 3022404-04-9 appears in our catalog under these names: 4-Bromo-6,7-dichloro-1H-indole, 95%, 95%, 4-Bromo-6,7-dichloro-1H-indole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-6,7-dichloro-1H-indole (CAS 3022404-04-9) is a chemical compound with the molecular formula C8H4BrCl2N and a molecular weight of 264.93 g/mol. IUPAC name: 4-bromo-6,7-dichloro-1H-indole. InChIKey: PZUZDTFBEHYJPV-UHFFFAOYSA-N.
| Molecular formula | C8H4BrCl2N |
|---|---|
| Molecular weight | 264.93 g/mol |
| IUPAC name | 4-bromo-6,7-dichloro-1H-indole |
| InChIKey | PZUZDTFBEHYJPV-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C(=CC(=C21)Br)Cl)Cl |
Computed by PubChem (NCBI)