Products 3022409-57-7
CAS 3022409-57-7 is the registry number for 6-chloro-7-fluoro-3-(1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl)-1H-indole, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
6-chloro-7-fluoro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indole (CAS 3022409-57-7) is a chemical compound with the molecular formula C16H15ClFN3O and a molecular weight of 319.76 g/mol. IUPAC name: 6-chloro-7-fluoro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indole. InChIKey: CVKMKCQQPJJOQU-UHFFFAOYSA-N.
| Molecular formula | C16H15ClFN3O |
|---|---|
| Molecular weight | 319.76 g/mol |
| IUPAC name | 6-chloro-7-fluoro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indole |
| InChIKey | CVKMKCQQPJJOQU-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C=C(C=N2)C3=CNC4=C3C=CC(=C4F)Cl |
Computed by PubChem (NCBI)