Products 3023019-99-7

CAS 3023019-99-7 is the registry number for HDAC6-IN-3, 98.0%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 10mM/1mL, 5 mg, 10 mg, 50 mg.

Structural formula: {0} (CAS {1})

N'-hydroxy-N-[3-[[methyl(prop-2-ynyl)amino]methyl]phenyl]octanediamide (CAS 3023019-99-7) is a chemical compound with the molecular formula C19H27N3O3 and a molecular weight of 345.4 g/mol. IUPAC name: N'-hydroxy-N-[3-[[methyl(prop-2-ynyl)amino]methyl]phenyl]octanediamide. InChIKey: FQVRLKIMFQKGHF-UHFFFAOYSA-N.

Identity
Molecular formulaC19H27N3O3
Molecular weight345.4 g/mol
IUPAC nameN'-hydroxy-N-[3-[[methyl(prop-2-ynyl)amino]methyl]phenyl]octanediamide
InChIKeyFQVRLKIMFQKGHF-UHFFFAOYSA-N
SMILESCN(CC#C)CC1=CC(=CC=C1)NC(=O)CCCCCCC(=O)NO

Computed by PubChem (NCBI)