CAS 1354029-51-8 is the registry number for Benzyl ((1-((S)-2-aminopropanoyl)pyrrolidin-3-yl)methyl)(cyclopropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[[1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]methyl]-N-cyclopropylcarbamate (CAS 1354029-51-8) is a chemical compound with the molecular formula C19H27N3O3 and a molecular weight of 345.4 g/mol. IUPAC name: benzyl N-[[1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]methyl]-N-cyclopropylcarbamate. InChIKey: AZMXTTOLMYGCJD-LBAUFKAWSA-N.
| Molecular formula | C19H27N3O3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | benzyl N-[[1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]methyl]-N-cyclopropylcarbamate |
| InChIKey | AZMXTTOLMYGCJD-LBAUFKAWSA-N |
| SMILES | C[C@@H](C(=O)N1CCC(C1)CN(C2CC2)C(=O)OCC3=CC=CC=C3)N |
Computed by PubChem (NCBI)