Products 30235-46-2
CAS 30235-46-2 is the registry number for 3-Hydroxy 5-Dibenzosuberenone. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
5-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one (CAS 30235-46-2) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: 5-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one. InChIKey: DZKWIQHKTSOUFU-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 5-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one |
| InChIKey | DZKWIQHKTSOUFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)