CAS 3023709-98-7 is the registry number for ELQ-596. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-chloro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1H-quinolin-4-one (CAS 3023709-98-7) is a chemical compound with the molecular formula C24H17ClF3NO3 and a molecular weight of 459.8 g/mol. IUPAC name: 6-chloro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1H-quinolin-4-one. InChIKey: ZFORXOUKLCZDHX-UHFFFAOYSA-N.
| Molecular formula | C24H17ClF3NO3 |
|---|---|
| Molecular weight | 459.8 g/mol |
| IUPAC name | 6-chloro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1H-quinolin-4-one |
| InChIKey | ZFORXOUKLCZDHX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=CC(=C(C=C2N1)OC)Cl)C3=CC=C(C=C3)C4=CC=C(C=C4)OC(F)(F)F |
Computed by PubChem (NCBI)