CAS 3023856-56-3 is the registry number for TMV-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-[[2-(benzotriazol-1-yl)acetyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid (CAS 3023856-56-3) is a chemical compound with the molecular formula C26H22N6O4 and a molecular weight of 482.5 g/mol. IUPAC name: 2-[[4-[[2-(benzotriazol-1-yl)acetyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: UWALOMGMSTVZSL-UHFFFAOYSA-N.
| Molecular formula | C26H22N6O4 |
|---|---|
| Molecular weight | 482.5 g/mol |
| IUPAC name | 2-[[4-[[2-(benzotriazol-1-yl)acetyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | UWALOMGMSTVZSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)C3=CC=C(C=C3)NC(=O)CN4C5=CC=CC=C5N=N4 |
Computed by PubChem (NCBI)