CAS 3024127-03-2 is the registry number for 2-(4-bicyclo[2.2.1]hept-2-ylphenyl)-4,4,5,5-tetramethyl-1,3,2-Dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[4-(2-bicyclo[2.2.1]heptanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 3024127-03-2) is a chemical compound with the molecular formula C19H27BO2 and a molecular weight of 298.2 g/mol. IUPAC name: 2-[4-(2-bicyclo[2.2.1]heptanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BAIKWBGIQUTONQ-UHFFFAOYSA-N.
| Molecular formula | C19H27BO2 |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | 2-[4-(2-bicyclo[2.2.1]heptanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BAIKWBGIQUTONQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3CC4CCC3C4 |
Computed by PubChem (NCBI)