CAS 3024271-84-6 is the registry number for SMARCA2 ligand-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[6-amino-5-(3,8-diazabicyclo[3.2.1]octan-3-yl)pyridazin-3-yl]-4-fluorophenol (CAS 3024271-84-6) is a chemical compound with the molecular formula C16H18FN5O and a molecular weight of 315.35 g/mol. IUPAC name: 2-[6-amino-5-(3,8-diazabicyclo[3.2.1]octan-3-yl)pyridazin-3-yl]-4-fluorophenol. InChIKey: DJWNEEIDVANISQ-UHFFFAOYSA-N.
| Molecular formula | C16H18FN5O |
|---|---|
| Molecular weight | 315.35 g/mol |
| IUPAC name | 2-[6-amino-5-(3,8-diazabicyclo[3.2.1]octan-3-yl)pyridazin-3-yl]-4-fluorophenol |
| InChIKey | DJWNEEIDVANISQ-UHFFFAOYSA-N |
| SMILES | C1CC2CN(CC1N2)C3=CC(=NN=C3N)C4=C(C=CC(=C4)F)O |
Computed by PubChem (NCBI)