Products 3024531-27-6
CAS 3024531-27-6 is the registry number for PPARγ agonist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,7-dimethoxy-2-phenyl-3-phenylmethoxychromen-4-one (CAS 3024531-27-6) is a chemical compound with the molecular formula C24H20O5 and a molecular weight of 388.4 g/mol. IUPAC name: 5,7-dimethoxy-2-phenyl-3-phenylmethoxychromen-4-one. InChIKey: SYAPZOACBBPGKH-UHFFFAOYSA-N.
| Molecular formula | C24H20O5 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 5,7-dimethoxy-2-phenyl-3-phenylmethoxychromen-4-one |
| InChIKey | SYAPZOACBBPGKH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C(=C(O2)C3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
Ppar|A agonist 2