CAS 3025012-68-1 is the registry number for DNMT1-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-(1,3-dioxoisoindol-2-yl)-3-(1,3,6-trichlorocarbazol-9-yl)propanoic acid (CAS 3025012-68-1) is a chemical compound with the molecular formula C23H13Cl3N2O4 and a molecular weight of 487.7 g/mol. IUPAC name: (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(1,3,6-trichlorocarbazol-9-yl)propanoic acid. InChIKey: YEBBNJGBFNBLTF-IBGZPJMESA-N.
| Molecular formula | C23H13Cl3N2O4 |
|---|---|
| Molecular weight | 487.7 g/mol |
| IUPAC name | (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(1,3,6-trichlorocarbazol-9-yl)propanoic acid |
| InChIKey | YEBBNJGBFNBLTF-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)[C@@H](CN3C4=C(C=C(C=C4)Cl)C5=C3C(=CC(=C5)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)