Products 302543-62-0
CAS 302543-62-0 appears in our catalog under these names: Rosiglitazone hydrochloride, 95%, Rosiglitazone hydrochloride/ 99.79% (existing batch purity), Rosiglitazone HCl, Rosiglitazone HCl - Bio-X â„¢, Rosiglitazone HCl. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 200mg, 500mg, 2g, 1g, 5g.
5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride (CAS 302543-62-0) is a chemical compound with the molecular formula C18H20ClN3O3S and a molecular weight of 393.9 g/mol. IUPAC name: 5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride. InChIKey: XRSCTTPDKURIIJ-UHFFFAOYSA-N.
| Molecular formula | C18H20ClN3O3S |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | 5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| InChIKey | XRSCTTPDKURIIJ-UHFFFAOYSA-N |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3.Cl |
Computed by PubChem (NCBI)