CAS 3026089-31-3 appears in our catalog under these names: (R,Z)-4-(Methylsulfonyl)but-3-en-2-amine tosylate, 98%, 98%, (R,Z)-4-(Methylsulfonyl)but-3-en-2-amine 4-methylbenzenesulfonate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
4-methylbenzenesulfonic acid;(Z,2R)-4-methylsulfonylbut-3-en-2-amine (CAS 3026089-31-3) is a chemical compound with the molecular formula C12H19NO5S2 and a molecular weight of 321.4 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;(Z,2R)-4-methylsulfonylbut-3-en-2-amine. InChIKey: RJEHTRUBNNMLEE-NLAZNZFMSA-N.
| Molecular formula | C12H19NO5S2 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;(Z,2R)-4-methylsulfonylbut-3-en-2-amine |
| InChIKey | RJEHTRUBNNMLEE-NLAZNZFMSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C[C@H](/C=C\S(=O)(=O)C)N |
Computed by PubChem (NCBI)