CAS 3026275-69-1 appears in our catalog under these names: Poly(9,9-dihexylfluorenyl-2,7-diyl) end capped with dimethylphenyl, I-2PACz, >98.0%(HPLC)(T). Offered by: Lumtec, TCI. Available pack sizes: On request, 500mg.
2-(3,6-diiodocarbazol-9-yl)ethylphosphonic acid (CAS 3026275-69-1) is a chemical compound with the molecular formula C14H12I2NO3P and a molecular weight of 527.03 g/mol. IUPAC name: 2-(3,6-diiodocarbazol-9-yl)ethylphosphonic acid. InChIKey: SDQPDHLWQALQCK-UHFFFAOYSA-N.
| Molecular formula | C14H12I2NO3P |
|---|---|
| Molecular weight | 527.03 g/mol |
| IUPAC name | 2-(3,6-diiodocarbazol-9-yl)ethylphosphonic acid |
| InChIKey | SDQPDHLWQALQCK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C3=C(N2CCP(=O)(O)O)C=CC(=C3)I |
Computed by PubChem (NCBI)