CAS 3026596-63-1 is the registry number for (R)-2-((6-fluoro-4-iodopyridin-2-yl)amino)propan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2R)-2-[(6-fluoro-4-iodo-2-pyridinyl)amino]propan-1-ol (CAS 3026596-63-1) is a chemical compound with the molecular formula C8H10FIN2O and a molecular weight of 296.08 g/mol. IUPAC name: (2R)-2-[(6-fluoro-4-iodo-2-pyridinyl)amino]propan-1-ol. InChIKey: XLFMRDVNKDSUAN-RXMQYKEDSA-N.
| Molecular formula | C8H10FIN2O |
|---|---|
| Molecular weight | 296.08 g/mol |
| IUPAC name | (2R)-2-[(6-fluoro-4-iodo-2-pyridinyl)amino]propan-1-ol |
| InChIKey | XLFMRDVNKDSUAN-RXMQYKEDSA-N |
| SMILES | C[C@H](CO)NC1=NC(=CC(=C1)I)F |
Computed by PubChem (NCBI)