Products 3026597-34-9
CAS 3026597-34-9 is the registry number for (2S,5R)-5-ethyl-2-methyl-1-tosylpiperazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2S,5R)-5-ethyl-2-methyl-1-(4-methylphenyl)sulfonylpiperazine (CAS 3026597-34-9) is a chemical compound with the molecular formula C14H22N2O2S and a molecular weight of 282.40 g/mol. IUPAC name: (2S,5R)-5-ethyl-2-methyl-1-(4-methylphenyl)sulfonylpiperazine. InChIKey: HOFBRPQRJMGGTI-QWHCGFSZSA-N.
| Molecular formula | C14H22N2O2S |
|---|---|
| Molecular weight | 282.40 g/mol |
| IUPAC name | (2S,5R)-5-ethyl-2-methyl-1-(4-methylphenyl)sulfonylpiperazine |
| InChIKey | HOFBRPQRJMGGTI-QWHCGFSZSA-N |
| SMILES | CC[C@@H]1CN([C@H](CN1)C)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)