Products 3026641-70-0
CAS 3026641-70-0 is the registry number for 8-(tert-butyl) 2-methyl (1S,5R)-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylate, 95%. Offered by: Chemat. Available pack sizes: 250mg.
8-O-tert-butyl 2-O-methyl (1S,5R)-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylate (CAS 3026641-70-0) is a chemical compound with the molecular formula C13H22N2O4 and a molecular weight of 270.32 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl (1S,5R)-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylate. InChIKey: QCPPZTYXTXLKNP-ZDGBYWQASA-N.
| Molecular formula | C13H22N2O4 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl (1S,5R)-3,8-diazabicyclo[3.2.1]octane-2,8-dicarboxylate |
| InChIKey | QCPPZTYXTXLKNP-ZDGBYWQASA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C(NC2)C(=O)OC |
Computed by PubChem (NCBI)