CAS 3026677-27-7 is the registry number for 1,3-Bis(methoxy-d3)-2-propanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-bis(trideuteriomethoxy)propan-2-one (CAS 3026677-27-7) is a chemical compound with the molecular formula C5H10O3 and a molecular weight of 124.17 g/mol. IUPAC name: 1,3-bis(trideuteriomethoxy)propan-2-one. InChIKey: SZVHDRLVQJXQBT-WFGJKAKNSA-N.
| Molecular formula | C5H10O3 |
|---|---|
| Molecular weight | 124.17 g/mol |
| IUPAC name | 1,3-bis(trideuteriomethoxy)propan-2-one |
| InChIKey | SZVHDRLVQJXQBT-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OCC(=O)COC([2H])([2H])[2H] |
Computed by PubChem (NCBI)