Products 3027139-12-1
CAS 3027139-12-1 is the registry number for TRPC antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-aminoethyl(naphthalen-2-ylmethyl)amino]-N-(4-hydroxyphenyl)-1,3-thiazole-4-carboxamide (CAS 3027139-12-1) is a chemical compound with the molecular formula C23H22N4O2S and a molecular weight of 418.5 g/mol. IUPAC name: 2-[2-aminoethyl(naphthalen-2-ylmethyl)amino]-N-(4-hydroxyphenyl)-1,3-thiazole-4-carboxamide. InChIKey: UKTIJZJOHLGMQZ-UHFFFAOYSA-N.
| Molecular formula | C23H22N4O2S |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 2-[2-aminoethyl(naphthalen-2-ylmethyl)amino]-N-(4-hydroxyphenyl)-1,3-thiazole-4-carboxamide |
| InChIKey | UKTIJZJOHLGMQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CN(CCN)C3=NC(=CS3)C(=O)NC4=CC=C(C=C4)O |
Computed by PubChem (NCBI)
Synonyms:
TRPC antagonist 1, orb3133342