CAS 3027608-60-9 is the registry number for NLRP3-IN-69. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[6-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxynaphthalen-2-yl]propanoic acid (CAS 3027608-60-9) is a chemical compound with the molecular formula C25H24O7 and a molecular weight of 436.5 g/mol. IUPAC name: (2S)-2-[6-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxynaphthalen-2-yl]propanoic acid. InChIKey: KOPOFKPWZZRPMV-RNOHYWCBSA-N.
| Molecular formula | C25H24O7 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | (2S)-2-[6-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxynaphthalen-2-yl]propanoic acid |
| InChIKey | KOPOFKPWZZRPMV-RNOHYWCBSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC(=O)/C=C/C3=CC(=C(C(=C3)OC)OC)OC)C(=O)O |
Computed by PubChem (NCBI)