Products 3027638-65-6
CAS 3027638-65-6 is the registry number for 9-([1,1'-Biphenyl]-3-yl)-9-(4-chlorophenyl)-9H-fluorene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9-(4-chlorophenyl)-9-(3-phenylphenyl)fluorene (CAS 3027638-65-6) is a chemical compound with the molecular formula C31H21Cl and a molecular weight of 428.9 g/mol. IUPAC name: 9-(4-chlorophenyl)-9-(3-phenylphenyl)fluorene. InChIKey: OICRJCHBMDTHDA-UHFFFAOYSA-N.
| Molecular formula | C31H21Cl |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | 9-(4-chlorophenyl)-9-(3-phenylphenyl)fluorene |
| InChIKey | OICRJCHBMDTHDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3(C4=CC=CC=C4C5=CC=CC=C53)C6=CC=C(C=C6)Cl |
Computed by PubChem (NCBI)