Products 3027742-68-0
CAS 3027742-68-0 is the registry number for 2',5'-Difluoro-4'-(1H-pyrazol-4-yl)-[1,1'-biphenyl]-4-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[2,5-difluoro-4-(1H-pyrazol-4-yl)phenyl]benzoic acid (CAS 3027742-68-0) is a chemical compound with the molecular formula C16H10F2N2O2 and a molecular weight of 300.26 g/mol. IUPAC name: 4-[2,5-difluoro-4-(1H-pyrazol-4-yl)phenyl]benzoic acid. InChIKey: NPTSLPPPBPYHMR-UHFFFAOYSA-N.
| Molecular formula | C16H10F2N2O2 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 4-[2,5-difluoro-4-(1H-pyrazol-4-yl)phenyl]benzoic acid |
| InChIKey | NPTSLPPPBPYHMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2F)C3=CNN=C3)F)C(=O)O |
Computed by PubChem (NCBI)