CAS 946387-17-3 is the registry number for N-(2,4-Difluorophenyl)-2-indol-3-yl-2-oxoethanamide. Offered by: Biosynth. Available pack sizes: 5000mg.
N-(2,4-difluorophenyl)-2-(1H-indol-3-yl)-2-oxoacetamide (CAS 946387-17-3) is a chemical compound with the molecular formula C16H10F2N2O2 and a molecular weight of 300.26 g/mol. IUPAC name: N-(2,4-difluorophenyl)-2-(1H-indol-3-yl)-2-oxoacetamide. InChIKey: BFSMNEVZLNVSHQ-UHFFFAOYSA-N.
| Molecular formula | C16H10F2N2O2 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | N-(2,4-difluorophenyl)-2-(1H-indol-3-yl)-2-oxoacetamide |
| InChIKey | BFSMNEVZLNVSHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C(=O)NC3=C(C=C(C=C3)F)F |
Computed by PubChem (NCBI)