Products 3028128-71-1
CAS 3028128-71-1 is the registry number for tert-butyl (2R,5R)-2,5-dimethyl-4-tosylpiperazine-1-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 5g.
Tert-butyl (2R,5R)-2,5-dimethyl-4-(4-methylphenyl)sulfonylpiperazine-1-carboxylate (CAS 3028128-71-1) is a chemical compound with the molecular formula C18H28N2O4S and a molecular weight of 368.5 g/mol. IUPAC name: tert-butyl (2R,5R)-2,5-dimethyl-4-(4-methylphenyl)sulfonylpiperazine-1-carboxylate. InChIKey: RDJAWZQPLQWJIE-HUUCEWRRSA-N.
| Molecular formula | C18H28N2O4S |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | tert-butyl (2R,5R)-2,5-dimethyl-4-(4-methylphenyl)sulfonylpiperazine-1-carboxylate |
| InChIKey | RDJAWZQPLQWJIE-HUUCEWRRSA-N |
| SMILES | C[C@@H]1CN([C@@H](CN1S(=O)(=O)C2=CC=C(C=C2)C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)