CAS 302821-53-0 is the registry number for SARS-CoV-2 3CLpro-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (E)-3-benzoyl-4-[5-(2-nitrophenyl)furan-2-yl]-2-oxobut-3-enoate (CAS 302821-53-0) is a chemical compound with the molecular formula C22H15NO7 and a molecular weight of 405.4 g/mol. IUPAC name: methyl (E)-3-benzoyl-4-[5-(2-nitrophenyl)furan-2-yl]-2-oxobut-3-enoate. InChIKey: PXEAOWXHVUSAAR-GHRIWEEISA-N.
| Molecular formula | C22H15NO7 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | methyl (E)-3-benzoyl-4-[5-(2-nitrophenyl)furan-2-yl]-2-oxobut-3-enoate |
| InChIKey | PXEAOWXHVUSAAR-GHRIWEEISA-N |
| SMILES | COC(=O)C(=O)/C(=C/C1=CC=C(O1)C2=CC=CC=C2[N+](=O)[O-])/C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)