CAS 302825-76-9 is the registry number for (R)-Verapamilic acid (S)-α-methylbenzylamine. Offered by: Biosynth. Available pack sizes: 250mg.
(4R)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid;1-phenylethanamine (CAS 302825-76-9) is a chemical compound with the molecular formula C24H32N2O4 and a molecular weight of 412.5 g/mol. IUPAC name: (4R)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid;1-phenylethanamine. InChIKey: VNKDXBXOHWCAIP-PKLMIRHRSA-N.
| Molecular formula | C24H32N2O4 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | (4R)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexanoic acid;1-phenylethanamine |
| InChIKey | VNKDXBXOHWCAIP-PKLMIRHRSA-N |
| SMILES | CC(C)[C@@](CCC(=O)O)(C#N)C1=CC(=C(C=C1)OC)OC.CC(C1=CC=CC=C1)N |
Computed by PubChem (NCBI)