CAS 3028442-70-5 is the registry number for HDAC6-IN-65. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[(2-chlorophenyl)sulfonyl-(pyridin-3-ylmethyl)amino]methyl]-N-hydroxybenzamide (CAS 3028442-70-5) is a chemical compound with the molecular formula C20H18ClN3O4S and a molecular weight of 431.9 g/mol. IUPAC name: 4-[[(2-chlorophenyl)sulfonyl-(pyridin-3-ylmethyl)amino]methyl]-N-hydroxybenzamide. InChIKey: OWFIIYCSCPRQDG-UHFFFAOYSA-N.
| Molecular formula | C20H18ClN3O4S |
|---|---|
| Molecular weight | 431.9 g/mol |
| IUPAC name | 4-[[(2-chlorophenyl)sulfonyl-(pyridin-3-ylmethyl)amino]methyl]-N-hydroxybenzamide |
| InChIKey | OWFIIYCSCPRQDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)N(CC2=CC=C(C=C2)C(=O)NO)CC3=CN=CC=C3)Cl |
Computed by PubChem (NCBI)