CAS 30286-75-0 appears in our catalog under these names: Oxitropium bromide, Oxitropium Bromide, Oxitropium (Bromide). Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 5mg, Get quote.
[(1R,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide (CAS 30286-75-0) is a chemical compound with the molecular formula C19H26BrNO4 and a molecular weight of 412.3 g/mol. IUPAC name: [(1R,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide. InChIKey: LCELQERNWLBPSY-YAYGZGPXSA-M.
| Molecular formula | C19H26BrNO4 |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | [(1R,2R,4S,5S)-9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide |
| InChIKey | LCELQERNWLBPSY-YAYGZGPXSA-M |
| SMILES | CC[N+]1([C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)C4=CC=CC=C4)C.[Br-] |
Computed by PubChem (NCBI)