CAS 3029-41-2 appears in our catalog under these names: (1E,3E,5E,7E,9E)-1,10-Diphenyldeca-1,3,5,7,9-pentaene, 98%, Poly(9,9-dioctylfluorenyl-2,7-diyl) end capped with N,N-bis(4-methylphenyl)aniline, (1E,3E,5E,7E,9E)–1,10–Diphenyldeca–1,3,5,7,9–pentaene. Offered by: Chemat Brand, Lumtec, GLPBio. Available pack sizes: on request, 1g.
[(1E,3E,5E,7E,9E)-10-phenyldeca-1,3,5,7,9-pentaenyl]benzene (CAS 3029-41-2) is a chemical compound with the molecular formula C22H20 and a molecular weight of 284.4 g/mol. IUPAC name: [(1E,3E,5E,7E,9E)-10-phenyldeca-1,3,5,7,9-pentaenyl]benzene. InChIKey: NODIXMQDAGGDJQ-GDHZPREYSA-N.
| Molecular formula | C22H20 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | [(1E,3E,5E,7E,9E)-10-phenyldeca-1,3,5,7,9-pentaenyl]benzene |
| InChIKey | NODIXMQDAGGDJQ-GDHZPREYSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/C=C/C=C/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)