Products 3029132-46-2
CAS 3029132-46-2 is the registry number for And1 degrader 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-[[4-(4-methylpiperazin-1-yl)anilino]methyl]phenol (CAS 3029132-46-2) is a chemical compound with the molecular formula C26H27Cl2N3O and a molecular weight of 468.4 g/mol. IUPAC name: 4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-[[4-(4-methylpiperazin-1-yl)anilino]methyl]phenol. InChIKey: FYYWLBTXXAQLEF-NSCUHMNNSA-N.
| Molecular formula | C26H27Cl2N3O |
|---|---|
| Molecular weight | 468.4 g/mol |
| IUPAC name | 4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-[[4-(4-methylpiperazin-1-yl)anilino]methyl]phenol |
| InChIKey | FYYWLBTXXAQLEF-NSCUHMNNSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NCC3=C(C=CC(=C3)/C=C/C4=CC(=C(C=C4)Cl)Cl)O |
Computed by PubChem (NCBI)
Synonyms:
And1 degrader 1, orb2665200