CAS 302926-99-4 is the registry number for BAS00132635. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-N,3-N-bis(3-hydroxyphenyl)-5-[(4-nitrobenzoyl)amino]benzene-1,3-dicarboxamide (CAS 302926-99-4) is a chemical compound with the molecular formula C27H20N4O7 and a molecular weight of 512.5 g/mol. IUPAC name: 1-N,3-N-bis(3-hydroxyphenyl)-5-[(4-nitrobenzoyl)amino]benzene-1,3-dicarboxamide. InChIKey: FYVRLIYUFDSNJO-UHFFFAOYSA-N.
| Molecular formula | C27H20N4O7 |
|---|---|
| Molecular weight | 512.5 g/mol |
| IUPAC name | 1-N,3-N-bis(3-hydroxyphenyl)-5-[(4-nitrobenzoyl)amino]benzene-1,3-dicarboxamide |
| InChIKey | FYVRLIYUFDSNJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)NC(=O)C2=CC(=CC(=C2)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-])C(=O)NC4=CC(=CC=C4)O |
Computed by PubChem (NCBI)