CAS 302941-52-2 appears in our catalog under these names: N,N'-Carbonylbis(L-glutamic Acid), >95% (HPLC), DUPA, 98%, DUPA/ 99.56% (existing batch purity), N,N'-Carbonylbis(L-glutamic acid), DUPA 98%. Offered by: TRC, AmBeed, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 10mg, 2mg, 100mg, 200mg, 500mg.
(2S)-2-[[(1S)-1,3-dicarboxypropyl]carbamoylamino]pentanedioic acid (CAS 302941-52-2) is a chemical compound with the molecular formula C11H16N2O9 and a molecular weight of 320.25 g/mol. IUPAC name: (2S)-2-[[(1S)-1,3-dicarboxypropyl]carbamoylamino]pentanedioic acid. InChIKey: SOAPXKSPJAZNGO-WDSKDSINSA-N.
| Molecular formula | C11H16N2O9 |
|---|---|
| Molecular weight | 320.25 g/mol |
| IUPAC name | (2S)-2-[[(1S)-1,3-dicarboxypropyl]carbamoylamino]pentanedioic acid |
| InChIKey | SOAPXKSPJAZNGO-WDSKDSINSA-N |
| SMILES | C(CC(=O)O)[C@@H](C(=O)O)NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)