CAS 302965-09-9 is the registry number for Ethyl 2,3,4-tri-O-benzoyl-b-D-thioglucopyranosiduronic acid methyl ester. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
Methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-ethylsulfanyloxane-2-carboxylate (CAS 302965-09-9) is a chemical compound with the molecular formula C30H28O9S and a molecular weight of 564.6 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-ethylsulfanyloxane-2-carboxylate. InChIKey: SIKVBXANIMEERD-OPXFDBJMSA-N.
| Molecular formula | C30H28O9S |
|---|---|
| Molecular weight | 564.6 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-ethylsulfanyloxane-2-carboxylate |
| InChIKey | SIKVBXANIMEERD-OPXFDBJMSA-N |
| SMILES | CCS[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)OC)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)