Products 3029657-80-2
CAS 3029657-80-2 is the registry number for Fmoc-L-Cys(Azidoethyl)-OH. Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(2R)-3-(2-azidoethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 3029657-80-2) is a chemical compound with the molecular formula C20H20N4O4S and a molecular weight of 412.5 g/mol. IUPAC name: (2R)-3-(2-azidoethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: BIKJGMVWKKLACY-SFHVURJKSA-N.
| Molecular formula | C20H20N4O4S |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | (2R)-3-(2-azidoethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | BIKJGMVWKKLACY-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CSCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)