CAS 1556861-34-7 is the registry number for STAT3-IN-52. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
5,8-dioxo-6-(2-piperazin-1-ylanilino)naphthalene-1-sulfonamide (CAS 1556861-34-7) is a chemical compound with the molecular formula C20H20N4O4S and a molecular weight of 412.5 g/mol. IUPAC name: 5,8-dioxo-6-(2-piperazin-1-ylanilino)naphthalene-1-sulfonamide. InChIKey: OESYHAALOVZISZ-UHFFFAOYSA-N.
| Molecular formula | C20H20N4O4S |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 5,8-dioxo-6-(2-piperazin-1-ylanilino)naphthalene-1-sulfonamide |
| InChIKey | OESYHAALOVZISZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC=C2NC3=CC(=O)C4=C(C3=O)C=CC=C4S(=O)(=O)N |
Computed by PubChem (NCBI)