Products 30299-29-7

CAS 30299-29-7 is the registry number for Clinofibrate Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-[4-[1-(4-hydroxyphenyl)cyclohexyl]phenoxy]-2-methylbutanoate (CAS 30299-29-7) is a chemical compound with the molecular formula C25H32O4 and a molecular weight of 396.5 g/mol. IUPAC name: ethyl 2-[4-[1-(4-hydroxyphenyl)cyclohexyl]phenoxy]-2-methylbutanoate. InChIKey: USOUKHSVWHSNMI-UHFFFAOYSA-N.

Identity
Molecular formulaC25H32O4
Molecular weight396.5 g/mol
IUPAC nameethyl 2-[4-[1-(4-hydroxyphenyl)cyclohexyl]phenoxy]-2-methylbutanoate
InChIKeyUSOUKHSVWHSNMI-UHFFFAOYSA-N
SMILESCCC(C)(C(=O)OCC)OC1=CC=C(C=C1)C2(CCCCC2)C3=CC=C(C=C3)O

Computed by PubChem (NCBI)