CAS 303014-64-4 is the registry number for Diethyl (3-chloro-4-methylphenyl)phosphonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-diethoxyphosphoryl-1-methylbenzene (CAS 303014-64-4) is a chemical compound with the molecular formula C11H16ClO3P and a molecular weight of 262.67 g/mol. IUPAC name: 2-chloro-4-diethoxyphosphoryl-1-methylbenzene. InChIKey: ZISMFSGZWGIBHQ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClO3P |
|---|---|
| Molecular weight | 262.67 g/mol |
| IUPAC name | 2-chloro-4-diethoxyphosphoryl-1-methylbenzene |
| InChIKey | ZISMFSGZWGIBHQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C1=CC(=C(C=C1)C)Cl)OCC |
Computed by PubChem (NCBI)