CAS 303041-88-5 appears in our catalog under these names: 4-Bromo-3-formylindole-1-carboxylic acid tert-butyl ester, 98%, 1-Boc-4-Bromo-3-formylindole 95%, 1-Boc-4-Bromo-3-formylindole, 95%, 95%, 1-Boc-4-Bromo-3-formylindole, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
Tert-butyl 4-bromo-3-formylindole-1-carboxylate (CAS 303041-88-5) is a chemical compound with the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. IUPAC name: tert-butyl 4-bromo-3-formylindole-1-carboxylate. InChIKey: URXQJQRVBNAQDT-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO3 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-formylindole-1-carboxylate |
| InChIKey | URXQJQRVBNAQDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC=C2Br)C=O |
Computed by PubChem (NCBI)