Products 3030492-40-8

CAS 3030492-40-8 is the registry number for HZ1, 99.20%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 50 mg, 10 mg.

Structural formula: {0} (CAS {1})

1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanone (CAS 3030492-40-8) is a chemical compound with the molecular formula C20H22N6O and a molecular weight of 362.4 g/mol. IUPAC name: 1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanone. InChIKey: NLCDEDGBGOOSNV-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22N6O
Molecular weight362.4 g/mol
IUPAC name1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]ethanone
InChIKeyNLCDEDGBGOOSNV-UHFFFAOYSA-N
SMILESCC(=O)C1=CC=C(C=C1)NC2=NC=CC(=N2)NC3=NNC(=C3)C4CCCC4

Computed by PubChem (NCBI)

Synonyms: orb2664487