Products 3030502-21-4
CAS 3030502-21-4 is the registry number for Antifungal agent 94. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(3-acetyl-5-butylsulfonyl-1-oxo-2H-1,3,4-thiadiazol-2-yl)-6-chlorochromen-4-one (CAS 3030502-21-4) is a chemical compound with the molecular formula C17H17ClN2O6S2 and a molecular weight of 444.9 g/mol. IUPAC name: 3-(3-acetyl-5-butylsulfonyl-1-oxo-2H-1,3,4-thiadiazol-2-yl)-6-chlorochromen-4-one. InChIKey: PGBPZLCRQYBMBB-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2O6S2 |
|---|---|
| Molecular weight | 444.9 g/mol |
| IUPAC name | 3-(3-acetyl-5-butylsulfonyl-1-oxo-2H-1,3,4-thiadiazol-2-yl)-6-chlorochromen-4-one |
| InChIKey | PGBPZLCRQYBMBB-UHFFFAOYSA-N |
| SMILES | CCCCS(=O)(=O)C1=NN(C(S1=O)C2=COC3=C(C2=O)C=C(C=C3)Cl)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 94, orb2566995